BindingDB logo
myBDB logout

21 SMILES Strings for Interleukin-8 receptors, CXCR1

Compound NameSMILES String
BDBM291172 CNC(=O)c1cccc(NC2C(NC(c3ccc(C)o3)C3(C)CCCO3)C(=O)C2=O)c1O
BDBM291179 CN(CC(F)(F)F)C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O
BDBM291181 CN(C)S(=O)(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1C
BDBM291192 CN(C)C(=O)c1c(Cl)ccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |w:15.15|
BDBM291188 Cc1ccc(o1)C(Nc1c(Nc2cccn(C)c2=O)c(=O)c1=O)C1CCCS1 |w:6.25|
BDBM291177 COC(=O)[C@H]1CCCN1C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |r|
BDBM291174 COC(=O)[C@@H]1CCCN1C(=O)c1cccc(Nc2c(NC([C@@H]3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1F |r,w:20.27|
BDBM236780 CN(C)C(=O)c1cccc(Nc2c(NC([C@H]3CCCO3)c3ccc(C)o3)c(=O)c2=O)c1O |r|
BDBM236781 CN(C)C(=O)c1cccc(Nc2c(NC([C@@H]3CCCO3)c3ccc(C)o3)c(=O)c2=O)c1O |r|
BDBM236782 CN(C)C(=O)c1cccc(Nc2c(NC(C3CCCO3)c3ccccc3)c(=O)c2=O)c1O
BDBM236783 CN(C)C(=O)c1cccc(Nc2c(NC([C@@H]3COC(C)(C)O3)c3ccc(C)o3)c(=O)c2=O)c1O |r|
BDBM236784 COC(=O)[C@@H]1CCCN1C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1F |r,w:20.21|
BDBM236785 Cc1ccc(o1)C(Nc1c(Nc2cccnc2O)c(=O)c1=O)C1CCCS1 |w:6.24|
BDBM236787 CN(CC(F)(F)F)C(=O)c1cccc(Nc2c(N[C@H](C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |r,w:19.23|
BDBM236788 COC(=O)CN(C)C(=O)c1cccc(Nc2c(N[C@H](C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |r,w:19.23|
BDBM236789 COC(=O)[C@H]1CCCN1C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |r,w:21.21|
BDBM236791 CN1CCN(CC1)S(=O)(=O)c1c(Cl)ccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O |w:20.21|
BDBM236804 CC(C)OC(=O)[C@@H]1CCCN1C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1F
BDBM236805 CCOC(=O)[C@@H]1CCCN1C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1F
BDBM236795 CN(C)C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O
BDBM291180 COC(=O)CN(C)C(=O)c1cccc(Nc2c(NC(C3CCCS3)c3ccc(C)o3)c(=O)c2=O)c1O