BindingDB logo
myBDB logout

84 SMILES Strings for Intestinal alkaline phosphatase (IAP)

Compound NameSMILES String
BDBM16652 NS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1
BDBM16661 NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1
BDBM18073 N[C@@H](Cc1ccccc1)C(O)=O
BDBM50004304 [O-][N+](=O)c1cccc(c1)C1=Nn2c(SC1)nnc2-c1ccncc1 |t:10|
BDBM50004311 Fc1ccc(cc1Cl)-c1nn2c(nnc2s1)-c1ccncc1
BDBM50004314 CCOc1ccc(Cc2nn3c(nnc3s2)-c2ccncc2)cc1
BDBM50004318 Cc1ccccc1OCc1nn2c(nnc2s1)-c1ccncc1
BDBM50004319 COc1ccc(OCc2nn3c(nnc3s2)-c2ccncc2)cc1
BDBM50004324 Fc1cccc(c1)C1=Nn2c(SC1)nnc2-c1ccncc1 |t:8|
BDBM50004326 C1Sc2nnc(-c3ccncc3)n2N=C1c1cccc2ccccc12 |c:15|
BDBM50004328 [K+].OP(O)([O-])=O
BDBM50004305 Clc1ccc(cc1Cl)C1=Nn2c(SC1)nnc2-c1ccncc1 |t:9|
BDBM50004306 Fc1cc(Cl)ccc1-c1nn2c(nnc2s1)-c1ccncc1
BDBM50004312 c1coc(c1)-c1nn2c(nnc2s1)-c1ccncc1
BDBM50004313 c1cc(co1)-c1nn2c(nnc2s1)-c1ccncc1
BDBM50004315 Oc1ccc(OCc2nn3c(nnc3s2)-c2ccncc2)cc1
BDBM50004322 Fc1ccc(OCc2nn3c(nnc3s2)-c2ccncc2)cc1
BDBM50004325 C1Sc2nnc(-c3ccncc3)n2N=C1c1ccc(cc1)-c1ccccc1 |c:15|
BDBM50241179 C1CN2C[C@@H](N=C2S1)c1ccccc1 |r,c:5|
BDBM50247721 NS(=O)(=O)c1ccc(CNS(=O)(=O)c2ccc(F)cc2)cc1
BDBM50320721 Nn1c(n[nH]c1=S)-c1ccncc1
BDBM50322604 OP(O)(=O)c1ccccc1S
BDBM50433370 Brc1ccc(cc1)-c1nnc2sc(nn12)-c1ccoc1
BDBM50428400 Cc1ccc(cc1)S(=O)(=O)Nc1ccccc1
BDBM50437927 CCOC1Oc2ccccc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1cc(OC)nc(OC)n1 |w:14.16|
BDBM50437928 CCOC1Oc2ccccc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1ccc(OC)nn1 |w:14.16|
BDBM50437929 CCOC1Oc2ccccc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1ccccn1 |w:14.16|
BDBM50437930 CCOC1Oc2ccc(Br)cc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1ccccn1 |w:15.17|
BDBM50437931 CCOC1Oc2ccccc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1nnc(C)s1 |w:14.16|
BDBM50437932 CCOC1Oc2ccc(F)cc2C(=O)C1=CNc1ccc(cc1)S(=O)(=O)Nc1nnc(C)s1 |w:15.17|
BDBM50437933 CCOC1Oc2ccc(CC)cc2C(=O)C1=CNc1ccccc1S(N)(=O)=O |w:16.18|
BDBM50437934 CCOC1Oc2c(Br)cc(Br)cc2C(=O)C1=CNc1ccccc1S(N)(=O)=O |w:16.18|
BDBM50437935 Brc1ccc2occ(C3Nc4ccccc4S(=O)(=O)N3)c(=O)c2c1
BDBM50437936 Fc1ccc2occ(C3Nc4ccccc4S(=O)(=O)N3)c(=O)c2c1
BDBM50437937 O=c1c(coc2ccccc12)C1Nc2ccccc2S(=O)(=O)N1
BDBM50437938 CCOC1Oc2ccc(CC)cc2C(=O)C1=CNc1cccc(c1)S(N)(=O)=O |w:16.18|
BDBM50437939 CCOC1Oc2c(Br)cc(Br)cc2C(=O)C1=CNc1cccc(c1)S(N)(=O)=O |w:16.18|
BDBM50437940 CCOC1Oc2ccc(Br)cc2C(=O)C1=CNc1cccc(c1)S(N)(=O)=O |w:15.17|
BDBM50437941 CCOC1Oc2ccc(F)cc2C(=O)C1=CNc1cccc(c1)S(N)(=O)=O |w:15.17|
BDBM50437942 CCOC1Oc2ccccc2C(=O)C1=CNc1cccc(c1)S(N)(=O)=O |w:14.16|
BDBM50437943 CCOC1Oc2ccc(CC)cc2C(=O)C1=CNc1ccc(cc1)S(N)(=O)=O |w:16.18|
BDBM50437944 CCOC1Oc2c(Br)cc(Br)cc2C(=O)C1=CNc1ccc(cc1)S(N)(=O)=O |w:16.18|
BDBM50437945 CCOC1Oc2ccc(Br)cc2C(=O)C1=CNc1ccc(cc1)S(N)(=O)=O |w:15.17|
BDBM50437946 CCOC1Oc2ccc(F)cc2C(=O)C1=CNc1ccc(cc1)S(N)(=O)=O |w:15.17|
BDBM50437947 CCOC1Oc2ccccc2C(=O)C1=CNc1ccc(cc1)S(N)(=O)=O |w:14.16|
BDBM50068218 NS(=O)(=O)c1ccc(CCNC(=O)c2ccccc2)cc1
BDBM50068219 NS(=O)(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1
BDBM50068221 NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(F)cc2)cc1
BDBM50068222 NS(=O)(=O)c1cccc(NC(=O)c2ccc(F)cc2)c1
BDBM50068223 Cc1ccc(cc1)S(=O)(=O)Nc1ccc(cc1)S(N)(=O)=O
BDBM50068226 Cc1ccc(cc1)S(=O)(=O)NCCc1ccc(cc1)S(N)(=O)=O
BDBM50068227 Cc1ccc(cc1)S(=O)(=O)Nc1cccc(c1)S(N)(=O)=O
BDBM50068228 NS(=O)(=O)c1ccc(CNC(=O)c2ccccc2)cc1
BDBM50068229 NS(=O)(=O)c1cccc(NS(=O)(=O)c2ccc(F)cc2)c1
BDBM50068230 CCOc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1
BDBM50068231 NS(=O)(=O)c1ccc(CCNS(=O)(=O)c2ccc(F)cc2)cc1
BDBM50068232 CCOc1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1
BDBM50068220 NS(=O)(=O)c1ccc(CNC(=O)c2ccc(F)cc2)cc1
BDBM50068225 Cc1ccc(cc1)S(=O)(=O)NCc1ccc(cc1)S(N)(=O)=O
BDBM50150070 C1C(N=C2SC=CN12)c1cc2ccccc2o1 |c:5,t:2|
BDBM222258 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2ccccc2Cl)cc1
BDBM222259 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2ccc(Cl)cc2Cl)cc1
BDBM222260 COc1cccc(\C=C\C(=O)C(=N\Nc2ccc(cc2)S(N)(=O)=O)\N2CCOCC2)c1
BDBM222262 COc1ccc(\C=C\C(=O)C(=N\Nc2ccc(cc2)S(N)(=O)=O)\N2CCOCC2)cc1OC
BDBM222263 COc1cc(\C=C\C(=O)C(=N\Nc2ccc(cc2)S(N)(=O)=O)\N2CCOCC2)cc(OC)c1OC
BDBM222261 COc1ccc(\C=C\C(=O)C(=N\Nc2ccc(cc2)S(N)(=O)=O)\N2CCOCC2)cc1
BDBM222264 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2ccccc2F)cc1
BDBM222265 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2cccc(F)c2)cc1
BDBM222266 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2ccccc2Br)cc1
BDBM222267 NS(=O)(=O)c1ccc(N\N=C(/N2CCOCC2)C(=O)\C=C\c2cccc(c2)[N+]([O-])=O)cc1
BDBM223071 Clc1ccc(\C=N\NC(=O)c2ccncc2)cc1
BDBM223072 Brc1ccc(\C=N\NC(=O)c2ccncc2)cc1
BDBM223073 Fc1ccc(\C=N\NC(=O)c2ccncc2)cc1
BDBM223074 COc1ccc(\C=N\NC(=O)c2ccncc2)cc1
BDBM223075 Oc1ccccc1\C=N\NC(=O)c1ccncc1
BDBM223076 [O-][N+](=O)c1cccc(\C=N\NC(=O)c2ccncc2)c1
BDBM223077 COc1cc(\C=N\NC(=O)c2ccncc2)ccc1O
BDBM223078 O=C(N\N=C\c1ccncc1)c1ccncc1
BDBM223079 O=C(N\N=C\c1cccnc1)c1ccncc1
BDBM223080 C\C(=N/NC(=O)c1ccncc1)N1N=C(CC1c1ccccc1)c1ccc(F)cc1 |c:14|
BDBM222179 CN(C)c1ccc2C(NS(=O)(=O)c3cccc1c23)c1ccccc1
BDBM222185 CN(C)c1ccc2C(NS(=O)(=O)c3cccc1c23)c1cc(Cl)cc(Cl)c1O
BDBM50150071 OC(Cn1ccsc1=N)c1cc2ccccc2o1
BDBM50150089 N=c1sccn1CC(=O)c1cc2ccccc2o1