BindingDB logo
myBDB logout

2 SMILES Strings for Intracellular chorismate mutase

Compound NameSMILES String
BDBM50390439 COc1cccc(c1)-n1cnc2sc3CCCCc3c2c1=O
BDBM50390440 CC(C)(C)OC(=O)N1CCc2c(C1)sc1ncn(-c3cccc(C=O)c3)c(=O)c21