BindingDB logo
myBDB logout

5 SMILES Strings for Iodotyrosine deiodinase (IYD)

Compound NameSMILES String
BDBM37633 N[C@@H](Cc1ccc(O)c(I)c1)C(O)=O
BDBM217397 Oc1ccccc1I
BDBM217398 Nc1ccc(O)c(I)c1
BDBM217399 OC(=O)c1ccc(O)c(I)c1
BDBM217400 Oc1ccc(cc1I)C#N