BindingDB logo
myBDB logout

2 SMILES Strings for Isocitrate dehydrogenase 2 mutant (R172S)

Compound NameSMILES String
BDBM195601 C[C@H](O)c1cccc(NC(=O)c2nn(Cc3ccc(F)cc3)c3[C@H](C)CN(Cc23)C(=O)c2ccc[nH]2)c1 |r|
BDBM195602 Cc1cccc(NC(=O)c2nn(Cc3c[nH]cn3)c3CCN(Cc23)C(=O)c2ccc[nH]2)c1