BindingDB logo
myBDB logout

1 SMILES String for Isoleucyl-tRNA synthetase (IleRS)

Compound NameSMILES String
BDBM188488 Nc1ncnc2n(cnc12)[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |r|