BindingDB logo
myBDB logout

1 SMILES String for JAK3

Compound NameSMILES String
BDBM102620 Cc1ccc(cc1NC(=O)C=C)-n1c2c(ccc1=O)cnc1ccc(cc21)-c1ccc(NS(C)(=O)=O)cc1