BindingDB logo
myBDB logout

5 SMILES Strings for Jumonji domain-containing protein 2A (JMJD2A)

Compound NameSMILES String
BDBM103845 CCCCCCCc1nc(C(=O)NCC(O)=O)c(O)c2ccccc12
BDBM103842 Cc1nc(C(=O)NCC(O)=O)c(O)c2ccccc12
BDBM103843 OC(=O)CNC(=O)c1nc(Cc2ccccc2)c2ccccc2c1O
BDBM103844 OC(=O)CNC(=O)c1nc(CC=C)c2ccccc2c1O
BDBM50193145 OC(=O)CNC(=O)c1nc(Cl)c2ccccc2c1O