BindingDB logo
myBDB logout

1 SMILES String for KHEYLRF-NH2 (AF2)

Compound NameSMILES String
BDBM86059 Nc1nc2n(cnc2c(=O)[nH]1)C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O