BindingDB logo
myBDB logout

10 SMILES Strings for KIAA1363

Compound NameSMILES String
BDBM26736 CN(C)C(=O)n1nnnc1Cc1ccc(cc1)-c1ccccc1
BDBM50448892 CS(=O)C=Cc1ccc(nc1)-c1cnc(o1)C(=O)CCCCCCc1ccccc1 |w:3.2|
BDBM50448893 CS(=O)(=O)C=Cc1ccc(nc1)-c1cnc(o1)C(=O)CCCCCCc1ccccc1 |w:4.3|
BDBM50448894 CCOS(=O)(=O)C=Cc1ccc(nc1)-c1cnc(o1)C(=O)CCCCCCc1ccccc1 |w:6.5|
BDBM50448895 COC(=N)Cc1ccc(nc1)-c1cnc(o1)C(=O)CCCCCCc1ccccc1
BDBM50448896 O=C(CCCCCCc1ccccc1)c1ncc(o1)-c1ccc(CC#N)cn1
BDBM50448897 BrCc1ccc(nc1)-c1cnc(o1)C(=O)CCCCCCc1ccccc1
BDBM50012157 O=C(C1CCc2cc(Oc3ccccc3)ccc2O1)c1ncc(o1)-c1ccccn1
BDBM50012169 O=C([C@H]1COc2cc(Oc3ccccc3)ccc2C1)c1ncc(o1)-c1ccccn1 |r|
BDBM50012171 O=C([C@@H]1COc2cc(Oc3ccccc3)ccc2C1)c1ncc(o1)-c1ccccn1 |r|