BindingDB logo
myBDB logout

3 SMILES Strings for Kaposi's sarcoma-associated herpesvirus (KSHV)

Compound NameSMILES String
BDBM36459 OC(=O)c1ccc(NC(=O)c2cccc(CC3CCCCC3)c2)c(Cc2ccccc2)c1
BDBM36460 OC(=O)c1ccc(NC(=O)c2cccc(CC3CCCCC3)n2)c(Cc2ccccc2)c1
BDBM36461 COc1ccc(cc1CC1CCCCC1)C(=O)Nc1ccc(cc1Cc1ccccc1)C(O)=O