BindingDB logo
myBDB logout

3 SMILES Strings for Kaposi's sarcoma-associated herpesvirus protease (KSHV Pr)

Compound NameSMILES String
BDBM36460 OC(=O)c1ccc(NC(=O)c2cccc(CC3CCCCC3)n2)c(Cc2ccccc2)c1
BDBM130376 O=C(Nc1ccc(cc1Cc1ccccc1)-c1nnn[nH]1)c1cccc(CC2CCCCC2)n1
BDBM130377 CS(=O)(=O)NC(=O)c1ccc(NC(=O)c2cccc(CC3CCCCC3)n2)c(Cc2ccccc2)c1