BindingDB logo
myBDB logout

1 SMILES String for KinA/Spo0F (sporulation kinase A/sporulation initiation phosphotransferase F)

Compound NameSMILES String
BDBM50215963 Cc1cc(NC(=O)c2cc(I)c(O)c(I)c2)c(Cl)cc1C(C#N)c1ccc(Cl)cc1