BindingDB logo
myBDB logout

1 SMILES String for Kinesin heavy chain isoform 5C

Compound NameSMILES String
BDBM50383087 Cc1ccc(cc1C)-n1c2nc(nc(C(N)=O)c2[nH]c1=O)-c1ccc(F)cc1F