BindingDB logo
myBDB logout

6 SMILES Strings for Kinesin-5 motor protein (KSP)

Compound NameSMILES String
BDBM23772 N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(O)=O |r|
BDBM115164 CCCC(C(=O)NCC(=O)OCC)n1c(Cc2ccccc2)nc2cc(Cl)c(Cl)cc12
BDBM115167 CCOC(=O)CNC(=O)C(C1CC1)n1c(Cc2ccccc2)nc2cc(Br)c(Br)cc12
BDBM115175 CCOC(=O)CNC(=O)C(C1CC1)n1c(nc2cc(Br)c(Br)cc12)C(=O)c1ccccc1
BDBM115177 CCCC(C(=O)NCC(=O)OCC)n1c(nc2cc(Br)c(Br)cc12)C(=O)c1ccccc1
BDBM115179 CCOC(=O)C1C(NC(=S)N=C1C)c1cccc(O)c1 |c:10|