BindingDB logo
myBDB logout

14 SMILES Strings for Kinesin-like protein KIF20A

Compound NameSMILES String
BDBM50140923 N#C\C(=C/c1cccnc1)c1c[nH]c2ccccc12
BDBM50140924 Clc1cccc(\C=C(/C#N)c2c[nH]c3ccccc23)c1
BDBM50140925 Fc1ccc(\C=C(/C#N)c2c[nH]c3ccccc23)cc1
BDBM50140934 N#CC(Cc1cccnc1)c1c[nH]c2ccccc12
BDBM50140935 N#C\C(=C/c1cccnc1)c1c[nH]c2ccc(OCc3ccccc3)cc12
BDBM50140928 N#C\C(=C/c1ccc2OCOc2c1)c1c[nH]c2ccccc12
BDBM50140931 COc1cccc2[nH]cc(\C(=C\c3cccnc3)C#N)c12
BDBM50140936 COc1ccc2[nH]c(C)c(\C(=C\c3cccnc3)C#N)c2c1
BDBM50140926 Clc1ccc(\C=C(/C#N)c2c[nH]c3ccccc23)cc1
BDBM50140927 COc1cc(OC)cc(\C=C(/C#N)c2c[nH]c3ccccc23)c1
BDBM50140929 COc1ccc2[nH]cc(\C(=C\c3cccnc3)C#N)c2c1
BDBM50140930 COc1ccc2c(c[nH]c2c1)C(=C\c1cccnc1)\C#N
BDBM50140932 N#C\C(=C/c1cccnc1)c1c[nH]c2ncccc12
BDBM50140933 N#C\C(=C/c1c[nH]c2ccccc12)c1cccnc1