BindingDB logo
myBDB logout

2 SMILES Strings for Kinesin-like protein KIF20B

Compound NameSMILES String
BDBM50056928 CCCCCc1cc(O)cc2OC(=O)c3c(Oc12)cc(O)cc3C(=O)CCCC
BDBM50056904 CCCCCC(=O)Cc1cc(O)cc2Oc3c(OC(=O)c12)cc(O)c(C(O)=O)c3CCCCC