BindingDB logo
myBDB logout

33 SMILES Strings for Kinesin-like protein KIF3B

Compound NameSMILES String
BDBM50293770 COc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(=O)Nc2ccccc2OC)cc1
BDBM50293771 NC1CCN(C1)c1nc2cc(ccc2n1Cc1ccccc1C(F)(F)F)C(O)=O
BDBM50293772 Cc1ccc(CNc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293773 COc1ccc(CNc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293774 CS(=O)(=O)c1ccc(CNc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293744 NC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293775 NS(=O)(=O)c1ccc(CNc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293776 OC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(NCCN3CCOCC3)nc2c1
BDBM50293745 CC(c1ccccc1C(F)(F)F)n1c(Nc2ccc(cc2)S(N)(=O)=O)nc2cc(ccc12)C(N)=O
BDBM50293746 NC(=O)c1ccc2n(c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1)C1(CC1)c1ccccc1
BDBM50293747 NC(=O)c1ccc2n(Cc3ccccn3)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293748 COc1ccccc1Cn1c(Nc2ccc(cc2)S(N)(=O)=O)nc2cc(ccc12)C(N)=O
BDBM50293749 COc1cccc(Cn2c(Nc3ccc(cc3)S(N)(=O)=O)nc3cc(ccc23)C(N)=O)c1OC
BDBM50293750 NC(=O)c1ccc2n(Cc3nc4ccccc4s3)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293751 NC(=O)c1ccc2n(Cc3csc4ccc(Cl)cc34)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293752 NC(=O)c1ccc2n(Cc3csc4ccccc34)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293753 CS(=O)(=O)c1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(N)=O)cc1
BDBM50293754 COc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(N)=O)cc1
BDBM50293755 COc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(N)=O)cc1F
BDBM50293756 CSc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(N)=O)cc1
BDBM50293757 NS(=O)(=O)c1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293758 CS(=O)(=O)c1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293759 COc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293760 COc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1F
BDBM50293761 CSc1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(O)=O)cc1
BDBM50293762 COC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293763 COC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(OC)cc3)nc2c1
BDBM50293764 COC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(SC)cc3)nc2c1
BDBM50293765 CNC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(OC)cc3)nc2c1
BDBM50293766 CNC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293767 CN(C)C(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1
BDBM50293768 NS(=O)(=O)c1ccc(Nc2nc3cc(ccc3n2Cc2ccccc2C(F)(F)F)C(=O)N2CCCC2)cc1
BDBM50293769 COc1ccccc1NC(=O)c1ccc2n(Cc3ccccc3C(F)(F)F)c(Nc3ccc(cc3)S(N)(=O)=O)nc2c1