BindingDB logo
myBDB logout

1 SMILES String for Kir3.1/Kir3.4

Compound NameSMILES String
BDBM50437968 CC(C)c1cc(NC(=O)Nc2cccc(c2)C(F)(F)F)n(Cc2ccccc2)n1