BindingDB logo
myBDB logout

8 SMILES Strings for Krueppel-like factor 10

Compound NameSMILES String
BDBM50108877 Cc1ccc(cc1)C(=O)c1cc(O)c(O)c(c1)[N+]([O-])=O
BDBM50366567 CNCC[C@@H](Oc1ccccc1C)c1ccccc1 |r|
BDBM50071809 Cc1cc(ccc1[N+]([O-])=O)C(=O)Nc1cnc(O)nc1O
BDBM50071810 CC(C)(c1ccc(O)c(CO)c1)c1ccc(O)c(CO)c1
BDBM50071811 Cc1ccc(OCC(=O)c2cc(C)c(O)cc2O)cc1
BDBM50071812 COc1ccc(cc1)C(=O)COC(=O)c1cc(C)ccc1O
BDBM50071808 COc1cc(O)c(C(C)=O)c(O)c1
BDBM50071813 Cc1sc2nc(SCC(=O)c3ccc(O)c(O)c3)[nH]c(=O)c2c1C