BindingDB logo
myBDB logout

39 SMILES Strings for Kruppel-like factor 5

Compound NameSMILES String
BDBM34853 Nc1cc2nn(nc2cc1Cl)-c1ccccc1
BDBM56897 COc1ccc(cc1)-n1nc2cc(C)c(NC(=O)C(C)C)cc2n1
BDBM70191 CC(C)(C)c1ccc(cc1)-c1noc(CCC(=O)Nc2ccccn2)n1
BDBM70192 CC(C)(C)c1ccc(cc1)-c1coc(CCC(=O)Nc2ccccn2)n1
BDBM70193 CC1(C)Cc2nc(NC(=O)c3ccc4ncsc4c3)sc2C(=O)C1
BDBM70194 CC(=O)Nc1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70195 CS(=O)(=O)c1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70196 CC(C)(C)C(=O)Nc1ccc2nn(nc2c1)-c1ccccc1
BDBM70197 Clc1cccc(c1)-n1nc2ccc(NC(=O)COc3ccccc3)cc2n1
BDBM70198 Cc1ccc(cc1)-n1nc2ccc(NC(=O)COc3ccc(C)c(C)c3)cc2n1
BDBM70199 Cc1ccc(OCC(=O)Nc2ccc3nn(nc3c2)-c2cccc(c2)C(F)(F)F)cc1C
BDBM70200 COc1ccc(cc1)-n1nc2ccc(NC(=O)C(C)(C)C)cc2n1
BDBM70201 CC(C)(C)C(=O)Nc1ccc2nn(nc2c1)-c1ccc(F)cc1
BDBM70202 COc1ccc(cc1)-n1nc2ccc(NC(=O)C3CCN(CC3)S(=O)(=O)c3ccc(Cl)cc3)cc2n1
BDBM70203 CC(C)C(=O)Nc1ccc2nn(nc2c1)-c1ccc(Cl)cc1
BDBM70204 Cc1ccc(cc1)-n1nc2cc(Cl)c(NC(=O)c3cccnc3)cc2n1
BDBM70205 CCOc1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70206 CC(C)c1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70207 COc1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70208 CC(=O)c1sc(NC(=O)c2ccc3ncsc3c2)nc1C
BDBM70209 CC(=O)c1sc(NC(=O)c2ccc3ncsc3c2)nc1-c1ccccc1
BDBM70210 CC(NC(=O)c1ccccc1)c1nc(no1)-c1ccc(cc1)C(C)(C)C
BDBM70211 Cc1cccc(NC(=O)CCc2nc(no2)-c2ccc(cc2)C(C)(C)C)c1
BDBM70212 CCOc1ccc(NC(=O)CCc2nc(no2)-c2ccc(cc2)C(C)(C)C)cc1
BDBM70213 CC(C)(C)c1ccc(cc1)-c1noc(CCCC(=O)Nc2ccccc2Cl)n1
BDBM70214 CCNC(=O)c1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70215 CN(C)C(=O)c1ccc2nc(Nc3nc4ccc(F)cc4s3)sc2c1
BDBM70216 CN(C)C(=O)c1sc(NC(=O)c2ccc3ncsc3c2)nc1C
BDBM70217 CCNC(=O)c1sc(NC(=O)c2ccc3ncsc3c2)nc1C
BDBM70218 CC(C)(C)c1ccc(cc1)-c1noc(CCC(=O)Nc2ccc(nc2)N2CCOCC2)n1
BDBM70219 CC(C)(C)c1ccc(cc1)-c1noc(CCC(=O)Nc2ccncc2)n1
BDBM70220 CC(C)(C)c1ccc(cc1)-c1noc(CCC(=O)NCc2ccccc2)n1
BDBM70221 CC(C)(C)c1ccc(cc1)-c1noc(CCC(=O)Nc2ccccc2)n1
BDBM70222 CC(C)(C)c1ccc(cc1)-c1noc(CCc2nc3ccccc3[nH]2)n1
BDBM70223 Clc1cc2nn(nc2cc1NC(=O)C1CC1)-c1ccccc1
BDBM70224 Clc1cc2nn(nc2cc1NC(=O)C1COc2ccccc2C1)-c1ccccc1
BDBM70225 Clc1cc2nn(nc2cc1NC(=O)Cc1ccccc1)-c1ccccc1
BDBM76096 CN(C1CCS(=O)(=O)C1)C(=O)COC(=O)\C=C\c1cccc(c1)[N+]([O-])=O
BDBM50286739 C[C@@H]1O[C@@H](O[C@H]2C[C@@H](O)[C@]3(CO)[C@H]4[C@H](O)C[C@]5(C)[C@H](CC[C@]5(O)[C@@H]4CC[C@]3(O)C2)C2=CC(=O)OC2)[C@H](O)[C@H](O)[C@H]1O |r,t:33|