BindingDB logo
myBDB logout

4 SMILES Strings for L‐Hydroxynicotine oxidase (LHNO)

Compound NameSMILES String
BDBM181053 C[NH+]1CCC[C@H]1c1ccc(=O)[nH]c1 |r|
BDBM181054 O=c1ccc(c[nH]1)[C@@H]1CCC[NH2+]1 |r|
BDBM181055 C1C[NH2+][C@@H](C1)c1cccnc1 |r|
BDBM181056 C[NH+]1CCC[C@H]1c1ccc(O)cc1 |r|