BindingDB logo
myBDB logout

1 SMILES String for L-6-hydroxynicotine oxidase (LHNO Y311F)

Compound NameSMILES String
BDBM217378 CN1CCC[C@H]1c1ccc(=O)[nH]c1