BindingDB logo
myBDB logout

25 SMILES Strings for L-lactate dehydrogenase A

Compound NameSMILES String
BDBM86115 O=c1[nH]n(-c2ccccc2)c2ncccc12
BDBM86116 COCCNc1ncnc2ccccc12
BDBM86117 CNc1nc2ccc(NC(C)=O)cc2s1
BDBM86118 NS(=O)(=O)c1ccc(O)c2ccccc12
BDBM86119 Clc1ccccc1-c1nnn[nH]1
BDBM86120 CC(=O)Nc1ccc2nc(C)sc2c1
BDBM86121 Cc1nc2ccc(NC(=O)CCC(O)=O)cc2s1
BDBM86122 CCCSc1nc2ccc(NC(=O)CCC(O)=O)cc2s1
BDBM86123 OC(=O)CCC(=O)Nc1ccc2nc(SCC=C)sc2c1
BDBM86124 OC(=O)C(Oc1ccc(Br)cc1)C(O)=O
BDBM86125 COc1ccc(CC(C(O)=O)C(O)=O)cc1OC
BDBM86126 Cc1nc2ccc(NC(=O)CCNC(N)=O)cc2s1
BDBM86127 CCCSc1nc2ccc(NC(=O)CCNC(N)=O)cc2s1
BDBM86128 CCNC(=O)NCCC(=O)Nc1ccc2nc(C)sc2c1
BDBM86129 COc1ccc(CC(C(O)=O)C(O)=O)cc1
BDBM86130 Cc1nc2ccc(NC(=O)CCNC(=O)NCCOc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86131 CCCSc1nc2ccc(NC(=O)CCNC(=O)NCCOc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86132 Cc1nc2ccc(NC(=O)CCNC(=O)NCCOc3ccc(CCC(O)=O)cc3)cc2s1
BDBM86133 Cc1nc2ccc(NC(=O)CCNC(=O)NCCc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86134 Cc1nc2ccc(NC(=O)CCNC(=O)NCCc3ccc(OC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86135 CCCSc1nc2ccc(NC(=O)CCNC(=O)NCCc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86136 CCCSc1nc2ccc(NC(=O)CCNC(=O)NCCc3ccc(OC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86137 Cc1nc2ccc(NC(=O)CCNC(=O)CCCc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM86138 CCCSc1nc2ccc(NC(=O)CCNC(=O)CCCc3ccc(CC(C(O)=O)C(O)=O)cc3)cc2s1
BDBM50078827 c1ccc2[nH]c(nc2c1)-c1cccnc1