BindingDB logo
myBDB logout

1 SMILES String for L-lactate dehydrogenase B chain

Compound NameSMILES String
BDBM50421763 NC(=O)c1csc(n1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2cnc3c(N)ncnc23)[C@H](O)[C@@H]1O |r|