BindingDB logo
myBDB logout

11 SMILES Strings for L-type amino acid transporter 1

Compound NameSMILES String
BDBM18073 N[C@@H](Cc1ccccc1)C(O)=O
BDBM50025836 NC1(CCc2c(C1)cccc2N(CCCl)CCCl)C(O)=O
BDBM50025837 N[C@@H](Cc1ccc(cc1)N(CCCl)CCCl)C(O)=O |r|
BDBM50025838 NC1(CCc2ccccc2C1)C(O)=O
BDBM50025839 NC1(CCc2ccc(cc2C1)N(CCCl)CCCl)C(O)=O
BDBM50319693 NC1(Cc2ccccc2C1)C(O)=O
BDBM50319694 NC1(Cc2ccc(cc2C1)N(CCCl)CCCl)C(O)=O
BDBM50319695 NC1(CC2CC1c1ccccc21)C(O)=O |THB:10:11:1.2:4,7:6:1.2:4,0:1:4:6.11|
BDBM50319696 NC1(CC2CC1c1cc(ccc21)N(CCCl)CCCl)C(O)=O |TLB:19:1:4:6.11,THB:10:11:1.2:4,7:6:1.2:4,0:1:4:6.11|
BDBM50319691 NC1(CCc2cc(ccc2C1)N(CCCl)CCCl)C(O)=O
BDBM50319692 NC1(CCc2cccc(N(CCCl)CCCl)c2C1)C(O)=O