BindingDB logo
myBDB logout

1 SMILES String for L-type calcium channel alpha 1C/beta 2A

Compound NameSMILES String
BDBM50227241 Cl.CCCCN(CCCC)CCCOc1ccc(cc1)-c1cn2ccc(C)nc2n1