BindingDB logo
myBDB logout

17 SMILES Strings for LDL receptor

Compound NameSMILES String
BDBM50052676 Cc1ccc(NC(=O)CCC2CCCCC2)cc1-c1nc2ccccc2[nH]1
BDBM50052677 Cc1ccc(cc1NC(=O)c1ccc(O)cc1)C(=O)NCCC1CCCCC1
BDBM50052678 Cc1ccc2nc([nH]c2c1)-c1cc(NC(=O)CCC2CCCCC2)ccc1C
BDBM50052679 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1ccccc1
BDBM50052680 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1ccc(O)cc1
BDBM50052681 Cc1ccc(NC(=O)CCC2CCCCC2)cc1\C=C(/C#N)c1ccc2OCOc2c1
BDBM50052682 Cc1ccc(NC(=O)CCC2CCCCC2)cc1-c1nc2ccc(O)cc2[nH]1
BDBM50052683 Cc1ccc(NC(=O)CCC2CCCCC2)cc1\C=C(/C#N)c1cccnc1
BDBM50052684 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1ccc(CO)cc1
BDBM50052685 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1ccc(N)cc1
BDBM50052686 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NCc1ccc2OCOc2c1
BDBM50052687 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1cccnc1
BDBM50052688 Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1cccc(O)c1
BDBM50052689 Cc1ccc(NC(=O)CCCC2CCCCC2)cc1NC(=O)c1ccc(O)cc1
BDBM50052690 CC(=O)Oc1ccc(cc1)C(=O)Nc1cc(NC(=O)CCC2CCCCC2)ccc1C
BDBM50052691 Cc1ccc(cc1NC(=O)c1cccnc1)C(=O)CCCC1CCCCC1
BDBM50052692 Cc1ccc(NC(=O)CCC2CCCCC2)cc1C(=O)Nc1ccc(O)cc1