BindingDB logo
myBDB logout

9 SMILES Strings for LIP1, secretory lipase (Family 3)

Compound NameSMILES String
BDBM50240877 O=[#6](-[#7]-[#6]-[#6]-[#6]-[#6]-[#6]-[#6]-[#7]-[#6](=O)-[#8]\[#7]=[#6]-1\[#6]-[#6]-[#6]-[#6]-[#6]-1)-[#8]\[#7]=[#6]-1\[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM50112881 O=C1N(CCSC(=S)N2CCOCC2)C(=O)c2ccccc12
BDBM50112883 O=C1N(CCSC(=S)N2CCCCCC2)Cc2ccccc12
BDBM50112884 Cc1ccc(cc1)C(=O)Oc1ccc2ccc(O)cc2c1
BDBM50112886 O=C1N(CCSC(=S)N2CCCC2)Cc2ccccc12
BDBM50112867 O=C1N(CCSC(=S)N2CCCCCC2)C(=O)c2ccccc12
BDBM50112880 O=C1N(CCSC(=S)N2CCCC2)C(=O)c2ccccc12
BDBM50112882 O=C1N(CCSC(=S)N2CCOCC2)Cc2ccccc12
BDBM50112885 OC(=O)c1ccc(=S)n(CC(=O)c2ccccc2)c1