BindingDB logo
myBDB logout

1 SMILES String for LISA-314

Compound NameSMILES String
BDBM200813 N[C@@H](CCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=N)N[C@H]12)C(O)=O |r|