BindingDB logo
myBDB logout

2 SMILES Strings for LISA-314 V21

Compound NameSMILES String
BDBM200813 N[C@@H](CCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=N)N[C@H]12)C(O)=O |r|
BDBM200814 OC(=O)CCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=N)N[C@H]12 |r|