BindingDB logo
myBDB logout

37 SMILES Strings for Lactate dehydrogenase (LDH)

Compound NameSMILES String
BDBM23222 NC(=O)C(O)=O
BDBM23223 CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=O)c2c1O |(-4.44,-1.63,;-5.78,-.86,;-7.11,-1.63,;-5.78,.68,;-7.11,1.45,;-8.44,.68,;-7.11,2.99,;-8.44,3.76,;-5.78,3.76,;-5.78,5.3,;-4.44,6.07,;-4.44,2.99,;-3.11,3.76,;-3.11,5.3,;-1.77,2.99,;-1.77,1.45,;-.44,.68,;-3.11,.68,;-4.44,1.45,;-.44,3.76,;-.44,5.3,;-1.77,6.07,;.89,6.07,;2.23,5.3,;3.56,6.07,;3.56,7.61,;4.89,8.38,;2.23,8.38,;4.89,5.3,;6.23,6.07,;4.89,3.76,;6.23,2.99,;3.56,2.99,;3.56,1.45,;4.89,.68,;2.23,3.76,;.89,2.99,;.89,1.45,)|
BDBM93321 OC(=O)C(=O)NCc1ccco1
BDBM93322 CC(C)CNC(=O)C(O)=O
BDBM93323 OC(=O)C(=O)NCCCCc1ccccc1
BDBM93324 OC(=O)C(=O)NCCc1ccc(Br)cc1
BDBM93290 COc1ccccc1NC(=O)C(O)=O
BDBM93291 Cc1cccc(c1)N(C(=O)C(O)=O)c1ccccc1
BDBM93292 CCc1ccccc1N(Cc1ccccc1)C(=O)C(O)=O
BDBM93293 CCCCCCCNC(=O)C(O)=O
BDBM93294 CN(CC=C)C(=O)C(O)=O
BDBM93295 CCCCNC(=O)C(O)=O
BDBM93296 CCCCCCCCCCCCCCCCNC(=O)C(O)=O
BDBM93297 Cc1ccc(CNC(=O)C(O)=O)o1
BDBM93298 CN(Cc1ccco1)C(=O)C(O)=O
BDBM93299 OC(=O)C(=O)NCc1cccc2ccccc12
BDBM93300 CC(C)c1ccc2c(CCC3[C@](C)(CNC(=O)C(O)=O)CCC[C@]23C)c1 |r|
BDBM93301 OC(=O)C(=O)N1CCN(Cc2ccccc2)CC1
BDBM93302 OC(=O)C(=O)N1CCC(Cc2ccccc2)CC1
BDBM93303 COCCNC(=O)C(O)=O
BDBM93304 OC(=O)C(=O)N(Cc1ccccc1)c1ccccc1
BDBM93305 CCCCCCNC(=O)C(O)=O
BDBM93306 CN(C(=O)C(O)=O)c1ccccc1
BDBM93307 COCCCNC(=O)C(O)=O
BDBM93308 CCCCCCCCCNC(=O)C(O)=O
BDBM93309 OC(=O)C(=O)N1CCN(CC1)c1ccccc1
BDBM93310 CCCCCN(C)C(=O)C(O)=O
BDBM93311 OC(=O)C(=O)N(CC=C)C1CCCCC1
BDBM93312 CN(Cc1ccccc1)C(=O)C(O)=O
BDBM93313 CCC(C)NC(=O)C(O)=O
BDBM93314 OC(=O)C(=O)N(Cc1ccccc1)Cc1ccccc1
BDBM93315 CC1CCCCN1C(=O)C(O)=O
BDBM93316 CC(C)CCNC(=O)C(O)=O
BDBM93317 OC(=O)C(=O)NCC1CCCO1
BDBM93318 OC(=O)C(=O)NCCC(c1ccccc1)c1ccccc1
BDBM93319 CSc1cccc(NC(=O)C(O)=O)c1
BDBM93320 CC(NC(=O)C(O)=O)c1cccc2CCCCc12