BindingDB logo
myBDB logout

9 SMILES Strings for Lactoperoxidase

Compound NameSMILES String
BDBM50241361 Cn1cc[nH]c1=S
BDBM50275891 COC(=O)n1ccn(C)c1=S
BDBM50275892 COC(=O)n1ccn(C)[c]1=[Se]
BDBM50275893 CCOC(=O)n1ccn(CC)c1=S
BDBM50275894 CCOC(=O)n1ccn(CC)[c]1=[Se]
BDBM50275895 CCn1ccn(C(=O)OC)c1=S
BDBM50275944 CCn1ccn(C(=O)OC)[c]1=[Se]
BDBM50275889 CCOC(=O)n1ccn(C)c1=S
BDBM50275890 CCOC(=O)n1ccn(C)[c]1=[Se]