BindingDB logo
myBDB logout

4 SMILES Strings for Lactoperoxidase (LPO)

Compound NameSMILES String
BDBM50015089 ONC(=O)c1ccccc1O
BDBM217355 ONC(=O)c1ccc(Cc2ccccc2)cc1O
BDBM217354 ONC(=O)c1cnc(NCc2cc(cc(c2)C(F)(F)F)C(F)(F)F)[nH]c1=O
BDBM217356 ONC(=O)c1c[nH]c(NCc2ccccc2)nc1=O