BindingDB logo
myBDB logout

10 SMILES Strings for Lactoylglutathione lyase

Compound NameSMILES String
BDBM50092826 N[C@@H](CCC(=O)N[C@@H](CSC(=O)N(O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O
BDBM50195360 N[C@@H](CNC(=O)N[C@@H](CSC(=O)N(O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O
BDBM50213420 N[C@@H](CCC(=O)N[C@@H](CCC(=O)CC(=O)OCc1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O
BDBM50213421 COC(=O)CC(=O)CC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O
BDBM50241121 N[C@@H](CCC(=O)N[C@@H](CSCc1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O |r|
BDBM50294133 N[C@@H](CNC(=O)N[C@@H](CSCc1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O |r|
BDBM50294134 N[C@@H](CCC(=O)N[C@@H](CCC(=O)N(O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O |r|
BDBM50294135 [NH3+][C@@H](CCC(=O)N[C@H](CCC(=O)N(O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O |r|
BDBM50294136 N[C@@H](CCC(=O)N[C@@H](CCN(O)C(=O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O |r|
BDBM50378037 NC(CNC(=O)NC(CCC(=O)N(O)c1ccc(Br)cc1)C(=O)NCC(O)=O)C(O)=O