BindingDB logo
myBDB logout

1 SMILES String for LanC-like protein 2

Compound NameSMILES String
BDBM50041087 C\C(\C=C\C1(O)C2(C)OC2C(=O)CC1(C)C)=C\C(O)=O