BindingDB logo
myBDB logout

3 SMILES Strings for Large neutral amino acids transporter small subunit 1

Compound NameSMILES String
BDBM50174343 N[C@@H](Cc1ccc(O)c(Cc2ccccc2)c1)C(O)=O |r|
BDBM50174344 N[C@@H](Cc1cccc(c1)-c1ccccc1)C(O)=O
BDBM50174345 N[C@@H](Cc1cccc(Cc2ccccc2)c1)C(O)=O |r|