BindingDB logo
myBDB logout

3 SMILES Strings for Large neutral amino acids transporter small subunit 3

Compound NameSMILES String
BDBM50190655 [H][C@@]12[C@@H](OC(C)=O)[C@]3(OC1(C)C)[C@H](C)CC[C@H](OC(C)=O)[C@@]3(COC(C)=O)[C@H](OC(=O)c1ccccc1)C2=O |r|
BDBM50190653 [H][C@@]12[C@@H](OC(C)=O)[C@]3(OC1(C)C)[C@H](C)CC[C@H](OC(C)=O)[C@@]3(C)[C@H](OC(=O)c1ccccc1)[C@@H]2OC(C)=O |r|
BDBM50190654 [H][C@@]12[C@@H](OC(C)=O)[C@]3(OC1(C)C)[C@H](C)CC[C@H](OC(C)=O)[C@@]3(COC(C)=O)[C@H](OC(=O)c1ccccc1)[C@@H]2O |r|