BindingDB logo
myBDB logout

26 SMILES Strings for LecB

Compound NameSMILES String
BDBM103994 COC1O[C@H](CNC(=O)Cc2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103995 COC1O[C@H](CNC(=O)C(c2ccccc2)c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103996 COC1O[C@H](CNC(=O)\C=C\c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103997 COC1O[C@H](CNCc2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103998 COC1O[C@H](CNCc2ccc(cc2)[N+](O)=O)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103999 COC1O[C@H](CNCc2ccc(cc2)C#N)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104000 COC1O[C@H](CNCc2ccc(Cl)cc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104001 COC1O[C@H](CN)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104002 COC1O[C@H](CNS(=O)(=O)c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104003 COC1O[C@H](CNS(=O)(=O)c2ccc(C)cc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104004 COC1O[C@H](CNS(=O)(=O)c2ccc(Br)cc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104005 COC1O[C@H](CNS(=O)(=O)c2ccc(cc2)[N+](O)=O)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104006 COC1O[C@H](CNS(=O)(=O)c2c(C)cc(C)cc2C)[C@@H](O)C(O)[C@@H]1O |r|
BDBM104008 COC1O[C@H](CNS(=O)(=O)\C=C\c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103981 COC1O[C@H](CO)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103982 CC1O[C@@H](OCCNC(=S)Nc2ccc(c(c2)C(O)=O)-c2c3ccc(O)cc3oc3cc(=O)ccc23)[C@@H](O)C(O)[C@@H]1O |r,wU:36.40,3.3,wD:40.45,(41.47,-13.76,;42.95,-13.36,;44.44,-13.76,;45.93,-13.36,;45.93,-11.82,;47.26,-11.05,;48.6,-11.82,;48.6,-13.36,;49.93,-14.13,;49.93,-15.67,;51.26,-13.36,;51.26,-11.82,;52.6,-11.05,;52.6,-9.51,;51.26,-8.74,;49.93,-9.51,;49.93,-11.05,;48.87,-8.97,;48.87,-7.69,;47.81,-9.74,;51.26,-7.2,;52.6,-6.43,;53.93,-7.2,;55.27,-6.43,;55.27,-4.89,;56.6,-4.12,;53.93,-4.12,;52.6,-4.89,;51.26,-4.12,;49.93,-4.89,;48.6,-4.12,;47.26,-4.89,;45.93,-4.12,;47.26,-6.43,;48.6,-7.2,;49.93,-6.43,;44.84,-14.45,;46.33,-14.06,;43.35,-14.06,;42.74,-15.14,;41.87,-14.45,;41.87,-15.99,)|
BDBM103983 COC1O[C@H](Cn2cc(CO)nn2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103984 COC1O[C@H](Cn2cc(CCc3ccccc3)nn2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103985 COC1O[C@H](Cn2cc(nn2)-c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103986 COC1O[C@H](Cn2cc(nn2)-c2cccc(C)c2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103987 COC1O[C@H](Cn2cc(nn2)-c2ccc(C)cc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103989 COC1O[C@H](Cn2cc(nn2)-c2ccc(F)cc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103990 COC1O[C@H](CNC(C)=O)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103991 COC1O[C@H](CNC(=O)c2ccccc2)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103992 COC1O[C@H](CNC(=O)c2ccc(cc2)[N+](O)=O)[C@@H](O)C(O)[C@@H]1O |r|
BDBM103993 COC1O[C@H](CNC(=O)c2cc(cc(c2)[N+](O)=O)[N+](O)=O)[C@@H](O)C(O)[C@@H]1O |r|