BindingDB logo
myBDB logout

2 SMILES Strings for Lecithin:cholesterol acyltransferase

Compound NameSMILES String
BDBM303816 CC(C)(C)OC(=O)N1CCC(CC1)c1cc(N)n(n1)C(c1ccccc1)c1ccccc1
BDBM303817 CC(C)(C)OC(=O)N1CCC(CC1)c1cc(N)n(n1)C(c1ccccc1)c1ccccc1