BindingDB logo
myBDB logout

4 SMILES Strings for Lecithin-cholesterol acyltransferase (LCAT)

Compound NameSMILES String
BDBM92616 CCCCCCCC(=O)OCC(COP([O-])(=O)OCC[N+](C)(C)C)CC(=O)C(F)(F)CCCCCC
BDBM92613 CCCCCCCC(=O)C(F)(F)CCOP([O-])(=O)OCC[N+](C)(C)C
BDBM92614 CCCCCCCCOCC(COP([O-])(=O)OCC[N+](C)(C)C)C(F)(F)C(=O)CCCCCCC
BDBM92615 CCCCCCCCCCCCCCCCC(=O)C(F)(F)C(COCCCCCCCC)COP([O-])(=O)OCC[N+](C)(C)C