BindingDB logo
myBDB logout

53 SMILES Strings for Leucine aminopeptidase (LAP)

Compound NameSMILES String
BDBM7459 Oc1cc(O)c2c(c1)oc(cc2=O)-c1ccc(O)c(O)c1
BDBM7460 Oc1cc(O)c2c(c1)oc(-c1ccc(O)c(O)c1)c(O)c2=O
BDBM50024594 CC(C)C[C@H]([NH3+])P(O)([O-])=O
BDBM50024597 CC(C)C[C@@H]([NH3+])P(O)([O-])=O
BDBM50078125 OP(O)C(=N)CCc1ccccc1
BDBM50129681 OC(=O)C(Cc1ccc(O)cc1)CP(O)(O)C(=N)CCc1ccccc1
BDBM50129684 OC(=O)C(Cc1ccccc1)CP(O)(O)C(=N)CCc1ccccc1
BDBM50157555 Oc1ccc(cc1O)-c1cc(=O)c2ccccc2o1
BDBM50316049 NC(CCc1ccccc1)P(O)(O)=O
BDBM50316030 CCCCC(N)P(O)(O)=O
BDBM50337147 NC(CCC1CCCCC1)P(O)(O)=O
BDBM50025042 NC(CCc1cccnc1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50025043 NC(CCc1ccc(CO)cc1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50025044 NC(CCc1ccc(O)cc1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50025045 NC(CCc1cccc(O)c1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50025047 Cc1cc(C)cc(CCC(N)P(O)(=O)CC(Cc2ccccc2)C(O)=O)c1
BDBM50025049 Cc1cc(C)cc(CC(CP(O)(=O)C(N)CCc2ccccc2)C(O)=O)c1
BDBM50025050 NCc1cccc(CC(CP(O)(=O)C(N)CCc2ccccc2)C(O)=O)c1
BDBM50025070 NCc1ccc(CC(CP(O)(=O)C(N)CCc2cccnc2)C(O)=O)cc1
BDBM50025099 NCc1cccc(CC(CP(O)(=O)C(N)CCc2ccncc2)C(O)=O)c1
BDBM50025046 NC(CCc1ccc(cc1)[N+]([O-])=O)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50025048 N[C@@H](CCc1ccccc1)P(O)(O)=O |r|
BDBM50025066 NCc1ccc(CC(CP(O)(=O)C(N)CCc2ccccc2)C(O)=O)cc1
BDBM50025041 NC(CCc1ccncc1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM234296 CCCCC(N)P(O)=O
BDBM234297 CSCCC(N)P(O)(=O)CC(C)C(O)=O
BDBM234298 CCCCC(N)P(O)(=O)O[C@@H](C)C(O)=O |r|
BDBM234299 CCCCC(N)P(O)(=O)O[C@@H](C)C(=O)OC |r|
BDBM234294 CSCCC(N)P(O)(O)=O
BDBM234295 CSCCC(N)P(O)=O
BDBM50170871 NC(CNCCN1CCNCC1)P(O)(O)=O
BDBM50170873 CC(C)(C)c1ccc(CNCC(N)P(O)(O)=O)cc1
BDBM50170874 NC(CNCCc1ccccc1)P(O)(O)=O
BDBM50170876 COc1ccc(CNCC(N)P(O)(O)=O)cc1
BDBM50170877 NCc1ccc(CNCC(N)P(O)(O)=O)cc1
BDBM50170878 COc1ccc(CCNCC(N)P(O)(O)=O)cc1
BDBM50170880 CCCNCC(N)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50170881 CC(C)CNCC(N)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50170882 NC(CNC1CCCCC1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50170883 NC(CNC1CCCCCC1)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50170891 NC(CNCc1ccccc1)P(O)(O)=O
BDBM50170893 NC(CN1CCCCC1)P(O)(O)=O
BDBM50170894 NC(CNCC1CCNCC1)P(O)(O)=O
BDBM50170895 NC(CNCC1CCCO1)P(O)(O)=O
BDBM50170898 CN(C)CCNCC(N)P(O)(O)=O
BDBM50170899 NCCNCC(N)P(O)(O)=O
BDBM50170900 CCCCCCNCC(N)P(O)(O)=O
BDBM50170875 NC(CNCc1ccc(N)cc1)P(O)(O)=O
BDBM50170884 COc1ccc(CCNCC(N)P(O)(=O)CC(Cc2ccccc2)C(O)=O)cc1
BDBM50170892 CC(NCC(N)P(O)(O)=O)c1ccccc1
BDBM50170897 NC(CNC1CCCCCC1)P(O)(O)=O
BDBM50170879 NCC(N)P(O)(=O)CC(Cc1ccccc1)C(O)=O
BDBM50170896 NC(CNC1CCCCC1N)P(O)(O)=O