BindingDB logo
myBDB logout

3 SMILES Strings for Leucine-rich repeat kinase 2 (LRRK2 t-WT)

Compound NameSMILES String
BDBM13530 CN1CCN(Cc2ccc(cc2)C(=O)Nc2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)CC1
BDBM50322535 CN1CCN(Cc2ccc(NC(=O)c3ccc(C)c(c3)C#Cc3cnc4cccnn34)cc2C(F)(F)F)CC1
BDBM228657 Cc1cc(Nc2nc(nc3ccccc23)-c2ccccc2)n[nH]1