BindingDB logo
myBDB logout

20 SMILES Strings for Leucyl-tRNA synthetase

Compound NameSMILES String
BDBM50075055 CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(CCc2ccc(Oc3ccccc3)cc2)cs1
BDBM50075057 N[C@@H](Cc1cnc[nH]1)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccccc1
BDBM50075060 N[C@@H](Cc1ccccc1)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccccc1
BDBM50075064 CC(C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccccc1
BDBM50075066 C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccccc1
BDBM50075067 CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccc(Oc2ccccc2)cc1
BDBM50075068 CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(cs1)-c1ccccc1
BDBM50075069 CC(C)C[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1nc(CCc2ccccc2)cs1
BDBM50093001 CC(C)[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1([C@@H](O)C[C@@H]2[C@H]1CN(C)C=C2C(N)=O)C(O)=O |c:25|
BDBM50093003 CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1([C@@H](O)C[C@@H]2[C@H]1CN(C)C=C2C(N)=O)C(O)=O |c:26|
BDBM50093004 CC[C@H](C)[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1([C@@H](O)C[C@@H]2[C@H]1CN(C)C=C2C(N)=O)C(=O)OC |c:26|
BDBM50093005 CC(C)C[C@H](N)C(=O)NS(=O)(=O)CC(=O)N[C@]1([C@@H](O)C[C@@H]2[C@H]1CN(C)C=C2C(N)=O)C(O)=O |c:26|
BDBM50111476 Clc1ccc(cc1)-c1ccc(OCCCCCN2CCN(C2=O)c2ccncc2)cc1
BDBM50171203 C[C@H](CCOc1ccc(cc1)-c1ccc(Cl)cc1)CCN1CCN(C1=O)c1ccncc1
BDBM50171204 C[C@@H](CCOc1ccc(cc1)-c1ccc(Cl)cc1)CCN1CCN(C1=O)c1ccncc1
BDBM50145676 Oc1c(Br)cc(\C=N\Nc2nc(cs2)-c2ccc(cc2)[N+]([O-])=O)cc1Br
BDBM50145674 CCOC(=O)c1sc(N\N=C\c2ccc(O)c(OC)c2)nc1C
BDBM50145675 COc1cc(\C=N\Nc2nc(cs2)-c2ccc(Cl)cc2)cc(Br)c1O
BDBM50145677 COc1cc(\C=N/Nc2nc(cs2)-c2ccc(cc2)[N+]([O-])=O)cc(c1O)[N+]([O-])=O
BDBM50145678 COc1cc(\C=N/Nc2nc(cs2)-c2ccc(Br)cc2)cc(c1O)[N+]([O-])=O