BindingDB logo
myBDB logout

1 SMILES String for Leucyl-tRNA synthetase K510E mutant (K510E)

Compound NameSMILES String
BDBM163674 CC[C@H]1O[C@H]([C@H]2O[B-]3(OCc4cc(F)ccc34)OC12)n1cnc2c(N)ncnc12 |r|