BindingDB logo
myBDB logout

3 SMILES Strings for Leukocyte common antigen

Compound NameSMILES String
BDBM13604 COC(CC(C)C)c1ccc2cc(cc(c2n1)P(O)(O)=O)-c1ccc(CC(Cc2ccc(cc2)C(F)(F)P(O)(O)=O)(c2ccccc2)n2nnc3ccccc23)cc1
BDBM50069998 OP(O)(=O)C(F)(F)c1ccc2cccc(c2c1)C(F)(F)P(O)([O-])=O
BDBM50142311 OP(O)(=O)C(F)(F)c1ccc(CC(Cc2ccc(cc2)C(F)(F)P(O)(O)=O)(C(=O)c2ccccc2)c2ccccc2)cc1