BindingDB logo
myBDB logout

37 SMILES Strings for Leukocyte proteinase 3

Compound NameSMILES String
BDBM50084637 CC(C)(C)C(=O)Oc1ccc(cc1)S(=O)(=O)Nc1ccccc1C(=O)NCC(O)=O
BDBM50171289 FS(=O)(=O)Cc1ccccc1
BDBM50270029 NCC(=O)N[C@@H](Cc1ccc(I)cc1)C(=O)[CH-][N+]#N |r|
BDBM50270040 [NH3+][C@@H](Cc1cccs1)C(=O)N[C@@]1(C[C@@H]1c1ccccc1)C#N |r|
BDBM50310690 N[C@@H](Cc1cccs1)C(=O)N[C@@]1(C[C@@H]1c1ccccc1)C#N |r|
BDBM50384104 COc1ccc(cc1)C(=O)n1c(O)c(oc1=O)-c1ccccc1
BDBM50384108 CC1(C)OC(=O)N(Cc2ccccc2)C1=O
BDBM50384111 COc1ccc(cc1)C(=O)N1C(=O)OC(C)(C)C1=O
BDBM50384112 Cc1ccc(cc1)S(=O)(=O)N1C(=O)OC(C)(C)C1=O
BDBM50444295 CC(C)(C)C(=O)Oc1cn(c(CSc2nc3cc(ccc3o2)C(O)=O)cc1=O)-c1ccccc1
BDBM50444296 CC(C)(C)C(=O)Oc1coc(CSc2nc3cc(ccc3o2)C(O)=O)cc1=O
BDBM50444297 CC(C)(C)C(=O)Oc1coc(CSc2nc3ccccc3s2)cc1=O
BDBM166437 CO\N=C(/C)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM166438 CO\N=C(\C)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063046 CC\C(=N\O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063047 C\C(=N\O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063049 CCCCC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063050 CCCC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063051 CCC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063052 CC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50063053 CC(C)(C)C(=O)Oc1ccc(cc1)S(=O)(=O)Nc1ccccc1C(=O)NCCO
BDBM50063054 CC(C)(C)C(=O)Oc1ccc(cc1)S(=O)(=O)Nc1ccccc1C(=O)OCCO
BDBM50031630 CCC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)c1ccccc1N)C(C)C)C(=O)C[C@@H](C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(N)=O)C(=O)NCCNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |r|
BDBM50031631 CCC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)c1ccccc1N)C(C)C)C(=O)C[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)NCCNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |r|
BDBM50063048 CC(C)(C)C(=O)Oc1ccc(cc1)S(=O)(=O)Nc1ccccc1C=O
BDBM50101978 COC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
BDBM50101981 COC(=O)c1ccccc1NS(=O)(=O)c1ccc(NC(=O)C(C)(C)C)cc1
BDBM50101977 CCCOC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
BDBM50101980 CCC\C(=N\O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50101982 CC(=O)c1ccccc1NS(=O)(=O)c1ccc(NS(=O)C(C)(C)C)cc1
BDBM50101983 CCOC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50101984 CCCOC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C)cc1
BDBM50101985 COC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
BDBM50101986 CCOC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
BDBM50101987 CC(C)(C)S(=O)Nc1ccc(cc1)S(=O)(=O)Nc1ccccc1C=O
BDBM50101988 CC(C)(C)C(=O)Oc1ccc(cc1)S(=O)(=O)Nc1ccccc1\C=N/O
BDBM50101989 COC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C)cc1