BindingDB logo
myBDB logout

2 SMILES Strings for Leukotriene B4

Compound NameSMILES String
BDBM85330 Cc1nccn1CC1CCc2c(C1=O)c1ccccc1n2C
BDBM50133817 CC(C)(C)c1ccc(NC(=O)N2CCN(CC2)c2ncccc2Cl)cc1