BindingDB logo
myBDB logout

2 SMILES Strings for Leukotriene B4 receptor 1

Compound NameSMILES String
BDBM50037218 O[C@@H]1[C@@H](Cc2ccc(cc2)-c2ccccc2)COc2cc(ccc12)C1(CCCC1)C(O)=O
BDBM50231569 Cc1nccn1C[C@H]1CCc2c(C1=O)c1cccc3CCCn2c13