BindingDB logo
myBDB logout

66 SMILES Strings for Leukotriene C4 synthase

Compound NameSMILES String
BDBM50359080 CCOc1ccc(cn1)-c1ccc(Cn2c(CC(C)(C)C(O)=O)c(SC(C)(C)C)c3cc(OCc4ccc(C)cn4)ccc23)cc1
BDBM50434668 Fc1cccc(Cl)c1-c1nc2c([nH]1)c(=O)[nH]c1cc(ccc21)-c1ccccc1
BDBM223230 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1(C)CC1)c1ccc(Cl)cc1
BDBM223231 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1(C)CC1)c1ccc2CCCc2c1
BDBM223227 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(Cl)cc1
BDBM223290 COc1cc(cnc1C(=O)[C@H]1C[C@@H]1C(O)=O)N(CC(C)C)c1cc(ccc1F)C(F)(F)F
BDBM223246 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(cc1F)C(F)(F)F
BDBM223247 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(c1Cl)C(F)(F)F
BDBM223248 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1c(C)ccc2ccccc12
BDBM223249 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(cc1)-c1ccccc1
BDBM223226 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(Cl)c2ccccc12
BDBM223250 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc2ccccc12
BDBM223251 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cc(F)cc2COCOc12
BDBM223252 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cc(Cl)cc2OCOc12
BDBM223253 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(C)c1C
BDBM223254 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(F)c(F)c1F
BDBM223255 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(F)c(Cl)c1F
BDBM223256 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(c1F)C(F)(F)F
BDBM223232 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(F)c2ccccc12
BDBM223233 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c2ncccc12
BDBM223234 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1cccc2ccccc12
BDBM223257 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1c(F)ccc(C)c1F
BDBM223258 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(C)c(F)c1F
BDBM223259 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(c2ccccc12)C(F)(F)F
BDBM223260 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(c2cccnc12)C(F)(F)F
BDBM223261 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc2CCc3cccc1c23
BDBM223262 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1cccc2c(cccc12)C(F)(F)F
BDBM223263 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc2cccc3CCc1c23
BDBM223235 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1cccc2c(C)ccnc12
BDBM223236 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c2ccccc12
BDBM223264 COc1cc(cnc1C(=O)C1CC1C(=O)NS(=O)(=O)c1ccccc1)N(CC1CC1)c1ccc(Cl)cc1
BDBM223265 COc1cc(cnc1C(=O)C1CC1C(=O)NS(=O)(=O)C1CC1)N(CC1CC1)c1ccc(Cl)cc1
BDBM223266 COc1ccc(cc1)S(=O)(=O)NC(=O)C1CC1C(=O)c1ncc(cc1OC)N(CC1CC1)c1ccc(Cl)cc1
BDBM223267 COc1cc(cnc1C(=O)C1CC1C(=O)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)N(CC1CC1)c1ccc(Cl)cc1
BDBM223268 COc1cc(cnc1C(=O)C1CC1C(=O)NS(=O)(=O)c1ccccc1F)N(CC1CC1)c1ccc(Cl)cc1
BDBM223269 COc1cc(ncc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c2ccccc12
BDBM223237 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc2ccccc2c1
BDBM223239 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(C)cc1
BDBM223270 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c2ccccc12
BDBM223271 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(F)c2ccccc12
BDBM223272 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(Cl)c2ccccc12
BDBM223273 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1cccc2ccccc12
BDBM223274 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(Cl)cc1
BDBM223275 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c(C)c1
BDBM223276 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(Cl)cc1
BDBM223228 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(C(C1CC1)C(F)(F)F)c1ccc(Cl)cc1
BDBM223277 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(C)c2ncccc12
BDBM223278 COc1cc(ccc1C(=O)C1CC1C(O)=O)N(CC1CC1)c1ccc(c2cccnc12)C(F)(F)F
BDBM223279 OC(=O)C1CC1C(=O)c1ccc(cn1)N(CC1CC1)c1ccc(Cl)cc1
BDBM223280 OC(=O)C1CC1C(=O)c1ccc(cn1)N(CC1CC1)Cc1ccc(Cl)cc1
BDBM223281 COc1nc(ncc1N(CC1CC1)c1ccc(Cl)c2ccccc12)C(=O)C1CC1C(O)=O
BDBM223282 COc1nc(ncc1N(CC1CC1)c1cccc2ccccc12)C(=O)C1CC1C(O)=O
BDBM223283 COc1nc(ncc1N(CC1CC1)c1ccc(F)c2ccccc12)C(=O)C1CC1C(O)=O
BDBM223284 COc1nc(ncc1N(CC1CC1)c1ccc(C)c2ccccc12)C(=O)C1CC1C(O)=O
BDBM223285 COc1cc(cnc1C(=O)C1CC1c1nnn[nH]1)N(CC1CC1)c1cccc2ccccc12
BDBM223286 COc1cc(cnc1C(=O)C1CC1c1nnn[nH]1)N(CC1CC1)c1ccc(F)c2ccccc12
BDBM223287 COc1nc(cnc1C(=O)[C@H]1C[C@@H]1C(O)=O)N(CC(C)(C)F)c1cc(Cl)c(F)cc1F
BDBM223288 COc1nc(cnc1C(=O)[C@H]1C[C@@H]1C(O)=O)N(CC(C)(C)F)c1cc(ccc1F)C(F)(F)F
BDBM223289 CCCN(c1cnc(C(=O)[C@H]2C[C@@H]2C(O)=O)c(OC)n1)c1cc(Cl)c(F)cc1F
BDBM223229 COCC(C1CC1)N(c1ccc(Cl)cc1)c1cnc(C(=O)C2CC2C(O)=O)c(OC)c1
BDBM223240 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(C)c1
BDBM223241 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1c(Cl)cccc1Cl
BDBM223242 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc2ccccc2c1
BDBM223243 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(Cl)c1
BDBM223244 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1ccc(F)cc1
BDBM223245 COc1cc(cnc1C(=O)C1CC1C(O)=O)N(CC1CC1)Cc1cccc(c1C)C(F)(F)F